Alkyl Halides
MEDCHEMEXPRESS LLC Rapastinel Trifluoroacetate | 1435786-04-1 | 98.0% | 527.49 | 50 MG
Rapastinel Trifluoroacetate | 1435786-04-1 | 98.0% | 527.49 | 50 MG
MEDCHEMEXPRESS LLC Bay-593 | 2413020-56-9 | 99.9% | 476.53 | 100 MG
BAY-593 is an orally active GGTase-I inhibitor that can block YAP1/TAZ signaling in animals and exhibits antitumor activity.
- Orally active GGTase-I inhibitor
- Blocks YAP1/TAZ signaling in animals
- Shows antitumor activity
MEDCHEMEXPRESS LLC Bis(2-bromoethyl) ether | 5414-19-7 | 99.9% | 231.92 | 5 G
Bis(2-bromoethyl) ether is an alkyl chain-based PROTAC linker, primarily used in the synthesis of PROTACs. These PROTACs are designed to contain two distinct ligands-one for an E3 ubiquitin ligase and another for a target protein-to leverage the intracellular ubiquitin-proteasome system for selective protein degradation.
- Alkyl chain-based PROTAC linker
- Used in the synthesis of PROTACs
- Appearance: Liquid
- Color: Colorless to light yellow
- Density: 1.845 g/cm3
- For research use only
Sigma Aldrich Fine Chemicals Biosciences Diamine Oxidase from porci10G
Diamine oxidase from porcine kidney is a homodimer consisting of two equal subunits with a molecular weight of 87 kDa each. Each subunit contains one molecule of pyridoxal phosphate and one atom of copper. The molecular mass of the enzyme is found to be 170 kDa. The enzyme is a glycoprotein containing 5% hexose 3.3% glucosamine 2.6% N-acetylglucosamine and 0.25% N-acetylneuraminic acid. The enzyme exhibits a high affinity for concanavalin A. Optimum pH with cadverine and histamine as substrates is found to be 6.3-7.4.
Chem-Impex International, Inc. Cyclopentyl bromide, 99% | 137-43-9 | MFCD00001359 | 250G
Cyclopentyl bromide, 99%, 137-43-9, MFCD00001359, 250G
![EMOLECULES INC 104304-10-1 | 1-(2-Bromoethyl)-1-azabicyclo[2.2.2]octan-1-ium bromide | Oakwood Chemical299.050 | C9H17Br2N | 95.000 | [Br-].BrCC[N+]12CCC(CC1)CC2 | 25mg | 537713292](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502150767.JPG-250.jpg)
EMOLECULES INC 104304-10-1 | 1-(2-Bromoethyl)-1-azabicyclo[2.2.2]octan-1-ium bromide | Oakwood Chemical299.050 | C9H17Br2N | 95.000 | [Br-].BrCC[N+]12CCC(CC1)CC2 | 25mg | 537713292
1-(2-Bromoethyl)-1-azabicyclo[2.2.2]octan-1-ium bromide | Oakwood Chemical | 104304-10-1299.050 | C9H17Br2N | 95.000 | [Br-].BrCC[N+]12CCC(CC1)CC2 | 25mg | 537713292
EMOLECULES INC 20965-27-9 | 7-Bromoheptanenitrile | Combi-Blocks, Inc. | MFCD00001982 | 190.084 | C7H12BrN | 98.000 | BrCCCCCCC#N | 25g | 603146252
7-Bromoheptanenitrile | Combi-Blocks, Inc. | 20965-27-9 | MFCD00001982 | 190.084 | C7H12BrN | 98.000 | BrCCCCCCC#N | 25g | 603146252
EMOLECULES INC 25812-80-0 | 6,7-Dibromobenzo(1,4)dioxan | Combi-Blocks | MFCD00463506 | 293.942 | C8H6Br2O2 | 98.000 | Brc1cc2OCCOc2cc1Br | 1g | 117543164
6,7-Dibromobenzo(1,4)dioxan | Combi-Blocks | 25812-80-0 | MFCD00463506 | 293.942 | C8H6Br2O2 | 98.000 | Brc1cc2OCCOc2cc1Br | 1g | 117543164
EMOLECULES INC 332-48-9 | 1-(2-Bromoethoxy)-4-fluorobenzene | Combi-Blocks | MFCD00044739 | 219.053 | C8H8BrFO | 98.000 | Fc1ccc(OCCBr)cc1 | 25g | 495744746
1-(2-Bromoethoxy)-4-fluorobenzene | Combi-Blocks | 332-48-9 | MFCD00044739 | 219.053 | C8H8BrFO | 98.000 | Fc1ccc(OCCBr)cc1 | 25g | 495744746
Sigma Aldrich Fine Chemicals Biosciences Iodomethane contains copper as stabilizer, ReagentPlus(R), 99% | 74-88-4 | MFCD00001073 | 25KG
Iodomethane contains copper as stabilizer, ReagentPlus(R), 99% | Purity: 99% | Mol Wt: 141.94 | 74-88-4 | MFCD00001073 | 25KG
Sigma Aldrich Fine Chemicals Biosciences Carbon tetrachloride | 56-23-5 | MFCD00000785 | 1L
Carbon tetrachloride | Purity: ≥99.9% | MW:153.82 | 56-23-5 | MFCD00000785 | 1L
EMOLECULES INC 1343722-88-2 | ChemScene | 4-Chloro-2-fluorobenzothioamide | 250mg | 572194186 | CS-0114061 | MFCD17290209 | 189.63 | C7H5ClFNS
ChemScene | Sodium tetrahydrofuran-3-sulfinate | 250mg | 801476584 | CS-0530358 | 1622013-59-5 | MFCD28124335 | 158.150 | C4H7NaO3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
EMOLECULES INC 1935618-88-4 | 7-CHLORO-5-METHOXYQUINOLINE | AstaTech | MFCD29761980 | 193.630 | C10H8ClNO | 95.000 | COc1cc(Cl)cc2ncccc12 | 0.1g | 798867630
7-CHLORO-5-METHOXYQUINOLINE | AstaTech | 1935618-88-4 | MFCD29761980 | 193.630 | C10H8ClNO | 95.000 | COc1cc(Cl)cc2ncccc12 | 0.1g | 798867630
![EMOLECULES INC 1733-88-6 | POTASSIUM PHENYL SULFATE | AstaTech | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502455664.PNG-250.jpg)
EMOLECULES INC 1733-88-6 | POTASSIUM PHENYL SULFATE | AstaTech | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741
POTASSIUM PHENYL SULFATE | AstaTech | 1733-88-6 | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741